N-DECYL PHENYL KETONE
Undecanophenone
CAS: 4433-30-1
Molecular Formula: C17H26O
N-DECYL PHENYL KETONE - Names and Identifiers
| Name | Undecanophenone |
| Synonyms | Undecanophenone UNDECANOPHENONE N-UNDECANOPHENONE DECYL PHENYL KETONE N-DECYL PHENYL KETONE n-Decyl phenyl ketone 1-phenylundecan-2-one 1-Phenyl-1-undecanone 1-Phenylundecane-1-one 1-Undecanone, 1-phenyl- |
| CAS | 4433-30-1 |
| EINECS | 224-633-9 |
| InChI | InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
N-DECYL PHENYL KETONE - Physico-chemical Properties
| Molecular Formula | C17H26O |
| Molar Mass | 246.39 |
| Density | 0.9384 (rough estimate) |
| Melting Point | 28-30 °C |
| Boling Point | 202-204°C 14mm |
| Flash Point | 202-204°C/14mm |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | powder to lump to clear liquid |
| Color | White or Colorless to Almost white or Almost colorless |
| BRN | 2211502 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.4830 (estimate) |
| MDL | MFCD00051548 |
N-DECYL PHENYL KETONE - Risk and Safety
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
N-DECYL PHENYL KETONE - Introduction
Undecanophenone(Undecanophenone) is an organic compound with the chemical formula C12H14O. The following is a description of its nature, use, preparation and safety information:
Nature:
1. appearance: colorless liquid.
2. Boiling point: about 263-265 degrees Celsius.
3. density: about 0.96 g/ml.
4. Solubility: Soluble in alcohols, ethers and most organic solvents.
Use:
1. Industrial use: Undecanophenone is commonly used as an intermediate for spices and fragrances, and is widely used as a fragrance enhancer for cosmetics, soaps, shampoos and other products.
2. Chemical synthesis: Undecanophenone can also be used as starting materials for the synthesis of other organic compounds, such as drugs and dyes.
Preparation Method:
Generally, Undecanophenone can be prepared by the reaction between undecanoic acid and a ketonizing agent (such as aluminum phosphate, methanol, and hydrochloric acid).
Safety Information:
1. Undecanophenone with low toxicity, but need to follow the general chemical safety procedures, avoid contact with skin and eyes.
2. In case of accidental contact, immediately flush the affected area with water and seek medical advice.
3. When using or storing Undecanophenone, avoid contact with strong oxidants, strong acids or strong bases to avoid dangerous reactions.
Nature:
1. appearance: colorless liquid.
2. Boiling point: about 263-265 degrees Celsius.
3. density: about 0.96 g/ml.
4. Solubility: Soluble in alcohols, ethers and most organic solvents.
Use:
1. Industrial use: Undecanophenone is commonly used as an intermediate for spices and fragrances, and is widely used as a fragrance enhancer for cosmetics, soaps, shampoos and other products.
2. Chemical synthesis: Undecanophenone can also be used as starting materials for the synthesis of other organic compounds, such as drugs and dyes.
Preparation Method:
Generally, Undecanophenone can be prepared by the reaction between undecanoic acid and a ketonizing agent (such as aluminum phosphate, methanol, and hydrochloric acid).
Safety Information:
1. Undecanophenone with low toxicity, but need to follow the general chemical safety procedures, avoid contact with skin and eyes.
2. In case of accidental contact, immediately flush the affected area with water and seek medical advice.
3. When using or storing Undecanophenone, avoid contact with strong oxidants, strong acids or strong bases to avoid dangerous reactions.
Last Update：2024-04-09 15:17:57
Supplier List
Product Name: Decyl Phenyl Ketone Visit Supplier Webpage Request for quotation
CAS: 4433-30-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4433-30-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: Decyl Phenyl Ketone Visit Supplier Webpage Request for quotation
CAS: 4433-30-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 4433-30-1
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History